C12H16BrF2N — CID 165344141
2-(2-bromo-4,5-difluorophenyl)-3,3-dimethylbutan-2-amine (PubChem CID 165344141) has the molecular formula C12H16BrF2N and a molecular weight of 292.17 g/mol. Its IUPAC name is 2-(2-bromo-4,5-difluorophenyl)-3,3-dimethylbutan-2-amine.
| Compound Name | 2-(2-bromo-4,5-difluorophenyl)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 165344141 |
| Molecular Formula | C12H16BrF2N |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-(2-bromo-4,5-difluorophenyl)-3,3-dimethylbutan-2-amine |
| SMILES | CC(C)(C)C(C)(N)c1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C12H16BrF2N/c1-11(2,3)12(4,16)7-5-9(14)10(15)6-8(7)13/h5-6H,16H2,1-4H3 |
| InChIKey | ZGODUJKPCVKDEC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|