C9H9BrF3N — CID 117111939
2-(3-bromo-2,4,5-trifluorophenyl)propan-2-amine (PubChem CID 117111939) has the molecular formula C9H9BrF3N and a molecular weight of 268.08 g/mol. Its IUPAC name is 2-(3-bromo-2,4,5-trifluorophenyl)propan-2-amine.
| Compound Name | 2-(3-bromo-2,4,5-trifluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 117111939 |
| Molecular Formula | C9H9BrF3N |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-(3-bromo-2,4,5-trifluorophenyl)propan-2-amine |
| SMILES | CC(C)(N)c1cc(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C9H9BrF3N/c1-9(2,14)4-3-5(11)8(13)6(10)7(4)12/h3H,14H2,1-2H3 |
| InChIKey | IOXYXGXMVUONHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|