C9H11F2NO2 — CID 84777103
4-(2-aminopropan-2-yl)-2,6-difluorobenzene-1,3-diol (PubChem CID 84777103) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 4-(2-aminopropan-2-yl)-2,6-difluorobenzene-1,3-diol.
| Compound Name | 4-(2-aminopropan-2-yl)-2,6-difluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 84777103 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4-(2-aminopropan-2-yl)-2,6-difluorobenzene-1,3-diol |
| SMILES | CC(C)(N)c1cc(F)c(O)c(F)c1O |
| InChI | InChI=1S/C9H11F2NO2/c1-9(2,12)4-3-5(10)8(14)6(11)7(4)13/h3,13-14H,12H2,1-2H3 |
| InChIKey | RPKDYMPIZGIFAX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|