About 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol
5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol (PubChem CID 84774489) has the molecular formula C11H16FNO
and a molecular weight of 197.25 g/mol. Its IUPAC name is 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol.
Molecular Properties
| Compound Name | 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol |
| PubChem CID | 84774489 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol |
| SMILES | Cc1cc(C(C)(C)N)c(C)c(O)c1F |
| InChI | InChI=1S/C11H16FNO/c1-6-5-8(11(3,4)13)7(2)10(14)9(6)12/h5,14H,13H2,1-4H3 |
| InChIKey | MUXAMNDUHRSMOT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol?
The IUPAC name of 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol (CID 84774489) is 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol.
What is the SMILES notation for 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol?
The canonical SMILES for 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol is Cc1cc(C(C)(C)N)c(C)c(O)c1F.
What is the InChIKey of 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol?
The InChIKey is MUXAMNDUHRSMOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FNO/c1-6-5-8(11(3,4)13)7(2)10(14)9(6)12/h5,14H,13H2,1-4H3.
What are the key properties of 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol?
5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol has a molecular weight of 197.25 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminopropan-2-yl)-2-fluoro-3,6-dimethylphenol is sourced from PubChem (CID 84774489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).