C11H16BrNO — CID 117398567
6-(2-aminopropan-2-yl)-2-bromo-3,4-dimethylphenol (PubChem CID 117398567) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 6-(2-aminopropan-2-yl)-2-bromo-3,4-dimethylphenol.
| Compound Name | 6-(2-aminopropan-2-yl)-2-bromo-3,4-dimethylphenol |
|---|---|
| PubChem CID | 117398567 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 6-(2-aminopropan-2-yl)-2-bromo-3,4-dimethylphenol |
| SMILES | Cc1cc(C(C)(C)N)c(O)c(Br)c1C |
| InChI | InChI=1S/C11H16BrNO/c1-6-5-8(11(3,4)13)10(14)9(12)7(6)2/h5,14H,13H2,1-4H3 |
| InChIKey | VXKNGFKSKROFLP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|