C10H15BrN2O — CID 130611702
2-bromo-6-[(1R)-1,2-diaminoethyl]-3,4-dimethylphenol (PubChem CID 130611702) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is 2-bromo-6-[(1R)-1,2-diaminoethyl]-3,4-dimethylphenol.
| Compound Name | 2-bromo-6-[(1R)-1,2-diaminoethyl]-3,4-dimethylphenol |
|---|---|
| PubChem CID | 130611702 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-bromo-6-[(1R)-1,2-diaminoethyl]-3,4-dimethylphenol |
| SMILES | Cc1cc([C@@H](N)CN)c(O)c(Br)c1C |
| InChI | InChI=1S/C10H15BrN2O/c1-5-3-7(8(13)4-12)10(14)9(11)6(5)2/h3,8,14H,4,12-13H2,1-2H3/t8-/m0/s1 |
| InChIKey | IXVGHUNLDQUEIM-QMMMGPOBSA-N |
| XLogP | 1.73 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|