C8H10BrClN2O — CID 130863163
2-bromo-3-chloro-6-[(1R)-1,2-diaminoethyl]phenol (PubChem CID 130863163) has the molecular formula C8H10BrClN2O and a molecular weight of 265.54 g/mol. Its IUPAC name is 2-bromo-3-chloro-6-[(1R)-1,2-diaminoethyl]phenol.
| Compound Name | 2-bromo-3-chloro-6-[(1R)-1,2-diaminoethyl]phenol |
|---|---|
| PubChem CID | 130863163 |
| Molecular Formula | C8H10BrClN2O |
| Molecular Weight | 265.54 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-bromo-3-chloro-6-[(1R)-1,2-diaminoethyl]phenol |
| SMILES | NC[C@H](N)c1ccc(Cl)c(Br)c1O |
| InChI | InChI=1S/C8H10BrClN2O/c9-7-5(10)2-1-4(8(7)13)6(12)3-11/h1-2,6,13H,3,11-12H2/t6-/m0/s1 |
| InChIKey | MNJIPWHIYVOKFR-LURJTMIESA-N |
| XLogP | 1.77 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|