C10H11Cl2NO — CID 131032181
6-[(1R)-1-aminobut-3-enyl]-2,3-dichlorophenol (PubChem CID 131032181) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is 6-[(1R)-1-aminobut-3-enyl]-2,3-dichlorophenol.
| Compound Name | 6-[(1R)-1-aminobut-3-enyl]-2,3-dichlorophenol |
|---|---|
| PubChem CID | 131032181 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 6-[(1R)-1-aminobut-3-enyl]-2,3-dichlorophenol |
| SMILES | C=CC[C@@H](N)c1ccc(Cl)c(Cl)c1O |
| InChI | InChI=1S/C10H11Cl2NO/c1-2-3-8(13)6-4-5-7(11)9(12)10(6)14/h2,4-5,8,14H,1,3,13H2/t8-/m1/s1 |
| InChIKey | UBGPCVJDIPQWTF-MRVPVSSYSA-N |
| XLogP | 3.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|