C8H8Cl3F2NO — CID 171257341
6-[(1S)-1-amino-2,2-difluoroethyl]-2,3-dichlorophenol;hydrochloride (PubChem CID 171257341) has the molecular formula C8H8Cl3F2NO and a molecular weight of 278.51 g/mol. Its IUPAC name is 6-[(1S)-1-amino-2,2-difluoroethyl]-2,3-dichlorophenol;hydrochloride.
| Compound Name | 6-[(1S)-1-amino-2,2-difluoroethyl]-2,3-dichlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171257341 |
| Molecular Formula | C8H8Cl3F2NO |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | 6-[(1S)-1-amino-2,2-difluoroethyl]-2,3-dichlorophenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(Cl)c(Cl)c1O)C(F)F |
| InChI | InChI=1S/C8H7Cl2F2NO.ClH/c9-4-2-1-3(6(13)8(11)12)7(14)5(4)10;/h1-2,6,8,14H,13H2;1H/t6-;/m0./s1 |
| InChIKey | NRMLRSUAONQGGM-RGMNGODLSA-N |
| XLogP | 3.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|