C11H14Cl3NO — CID 171257346
6-[(R)-amino(cyclobutyl)methyl]-2,3-dichlorophenol;hydrochloride (PubChem CID 171257346) has the molecular formula C11H14Cl3NO and a molecular weight of 282.60 g/mol. Its IUPAC name is 6-[(R)-amino(cyclobutyl)methyl]-2,3-dichlorophenol;hydrochloride.
| Compound Name | 6-[(R)-amino(cyclobutyl)methyl]-2,3-dichlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171257346 |
| Molecular Formula | C11H14Cl3NO |
| Molecular Weight | 282.60 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 6-[(R)-amino(cyclobutyl)methyl]-2,3-dichlorophenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(Cl)c(Cl)c1O)C1CCC1 |
| InChI | InChI=1S/C11H13Cl2NO.ClH/c12-8-5-4-7(11(15)9(8)13)10(14)6-2-1-3-6;/h4-6,10,15H,1-3,14H2;1H/t10-;/m1./s1 |
| InChIKey | AYSIGBJYVNXBMY-HNCPQSOCSA-N |
| XLogP | 3.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|