C8H10ClF3N2O — CID 171257382
2-amino-6-[(1S)-1-amino-2,2-difluoroethyl]-3-fluorophenol;hydrochloride (PubChem CID 171257382) has the molecular formula C8H10ClF3N2O and a molecular weight of 242.63 g/mol. Its IUPAC name is 2-amino-6-[(1S)-1-amino-2,2-difluoroethyl]-3-fluorophenol;hydrochloride.
| Compound Name | 2-amino-6-[(1S)-1-amino-2,2-difluoroethyl]-3-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171257382 |
| Molecular Formula | C8H10ClF3N2O |
| Molecular Weight | 242.63 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-amino-6-[(1S)-1-amino-2,2-difluoroethyl]-3-fluorophenol;hydrochloride |
| SMILES | Cl.Nc1c(F)ccc([C@H](N)C(F)F)c1O |
| InChI | InChI=1S/C8H9F3N2O.ClH/c9-4-2-1-3(5(12)8(10)11)7(14)6(4)13;/h1-2,5,8,14H,12-13H2;1H/t5-;/m0./s1 |
| InChIKey | LZTWNPMGJGNNMW-JEDNCBNOSA-N |
| XLogP | 1.80 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|