C8H9F3N2O — CID 131197380
2-amino-6-[(1S)-1-amino-2,2-difluoroethyl]-3-fluorophenol (PubChem CID 131197380) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is 2-amino-6-[(1S)-1-amino-2,2-difluoroethyl]-3-fluorophenol.
| Compound Name | 2-amino-6-[(1S)-1-amino-2,2-difluoroethyl]-3-fluorophenol |
|---|---|
| PubChem CID | 131197380 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-amino-6-[(1S)-1-amino-2,2-difluoroethyl]-3-fluorophenol |
| SMILES | Nc1c(F)ccc([C@H](N)C(F)F)c1O |
| InChI | InChI=1S/C8H9F3N2O/c9-4-2-1-3(5(12)8(10)11)7(14)6(4)13/h1-2,5,8,14H,12-13H2/t5-/m0/s1 |
| InChIKey | ZLVKSDCECNVHRT-YFKPBYRVSA-N |
| XLogP | 1.38 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|