C8H7F4NO — CID 130817233
6-[(1S)-1-amino-2,2-difluoroethyl]-2,3-difluorophenol (PubChem CID 130817233) has the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. Its IUPAC name is 6-[(1S)-1-amino-2,2-difluoroethyl]-2,3-difluorophenol.
| Compound Name | 6-[(1S)-1-amino-2,2-difluoroethyl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 130817233 |
| Molecular Formula | C8H7F4NO |
| Molecular Weight | 209.14 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-[(1S)-1-amino-2,2-difluoroethyl]-2,3-difluorophenol |
| SMILES | N[C@@H](c1ccc(F)c(F)c1O)C(F)F |
| InChI | InChI=1S/C8H7F4NO/c9-4-2-1-3(6(13)8(11)12)7(14)5(4)10/h1-2,6,8,14H,13H2/t6-/m0/s1 |
| InChIKey | CMJGSCJETWHBNT-LURJTMIESA-N |
| XLogP | 1.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|