C9H13BrCl2N2O — CID 171257185
2-bromo-3-chloro-6-[(1R)-1,3-diaminopropyl]phenol;hydrochloride (PubChem CID 171257185) has the molecular formula C9H13BrCl2N2O and a molecular weight of 316.03 g/mol. Its IUPAC name is 2-bromo-3-chloro-6-[(1R)-1,3-diaminopropyl]phenol;hydrochloride.
| Compound Name | 2-bromo-3-chloro-6-[(1R)-1,3-diaminopropyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171257185 |
| Molecular Formula | C9H13BrCl2N2O |
| Molecular Weight | 316.03 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 2-bromo-3-chloro-6-[(1R)-1,3-diaminopropyl]phenol;hydrochloride |
| SMILES | Cl.NCC[C@@H](N)c1ccc(Cl)c(Br)c1O |
| InChI | InChI=1S/C9H12BrClN2O.ClH/c10-8-6(11)2-1-5(9(8)14)7(13)3-4-12;/h1-2,7,14H,3-4,12-13H2;1H/t7-;/m1./s1 |
| InChIKey | NLUXPAQJSRFUCF-OGFXRTJISA-N |
| XLogP | 2.58 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.03 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|