C8H10ClFN2O — CID 131010003
3-chloro-2-[(1R)-1,2-diaminoethyl]-6-fluorophenol (PubChem CID 131010003) has the molecular formula C8H10ClFN2O and a molecular weight of 204.63 g/mol. Its IUPAC name is 3-chloro-2-[(1R)-1,2-diaminoethyl]-6-fluorophenol.
| Compound Name | 3-chloro-2-[(1R)-1,2-diaminoethyl]-6-fluorophenol |
|---|---|
| PubChem CID | 131010003 |
| Molecular Formula | C8H10ClFN2O |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-chloro-2-[(1R)-1,2-diaminoethyl]-6-fluorophenol |
| SMILES | NC[C@H](N)c1c(Cl)ccc(F)c1O |
| InChI | InChI=1S/C8H10ClFN2O/c9-4-1-2-5(10)8(13)7(4)6(12)3-11/h1-2,6,13H,3,11-12H2/t6-/m0/s1 |
| InChIKey | CTGFASJEKLEZLV-LURJTMIESA-N |
| XLogP | 1.14 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|