C8H10Cl2N2O — CID 10100975
3,5-dichloro-4-(1,2-diaminoethyl)phenol (PubChem CID 10100975) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 3,5-dichloro-4-(1,2-diaminoethyl)phenol.
| Compound Name | 3,5-dichloro-4-(1,2-diaminoethyl)phenol |
|---|---|
| PubChem CID | 10100975 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 3,5-dichloro-4-(1,2-diaminoethyl)phenol |
| SMILES | NCC(N)c1c(Cl)cc(O)cc1Cl |
| InChI | InChI=1S/C8H10Cl2N2O/c9-5-1-4(13)2-6(10)8(5)7(12)3-11/h1-2,7,13H,3,11-12H2 |
| InChIKey | GGOAVIZGZAGIGF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |