C9H9ClFNO3 — CID 84796511
3-amino-2-(2-chloro-6-fluoro-4-hydroxyphenyl)propanoic acid (PubChem CID 84796511) has the molecular formula C9H9ClFNO3 and a molecular weight of 233.63 g/mol. Its IUPAC name is 3-amino-2-(2-chloro-6-fluoro-4-hydroxyphenyl)propanoic acid.
| Compound Name | 3-amino-2-(2-chloro-6-fluoro-4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 84796511 |
| Molecular Formula | C9H9ClFNO3 |
| Molecular Weight | 233.63 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 3-amino-2-(2-chloro-6-fluoro-4-hydroxyphenyl)propanoic acid |
| SMILES | NCC(C(=O)O)c1c(F)cc(O)cc1Cl |
| InChI | InChI=1S/C9H9ClFNO3/c10-6-1-4(13)2-7(11)8(6)5(3-12)9(14)15/h1-2,5,13H,3,12H2,(H,14,15) |
| InChIKey | HGMMQFZKEKPQJB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.63 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |