About 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid
3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid (PubChem CID 117364248) has the molecular formula C11H13F2NO3
and a molecular weight of 245.22 g/mol. Its IUPAC name is 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid.
Analyze 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid?
The IUPAC name of 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid (CID 117364248) is 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid.
What is the SMILES notation for 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid?
The canonical SMILES for 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid is COCc1ccc(F)c(C(CN)C(=O)O)c1F.
What is the InChIKey of 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid?
The InChIKey is DZFUCZFVASYMJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO3/c1-17-5-6-2-3-8(12)9(10(6)13)7(4-14)11(15)16/h2-3,7H,4-5,14H2,1H3,(H,15,16).
What are the key properties of 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid?
3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid has a molecular weight of 245.22 g/mol, XLogP of 1.24, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[2,6-difluoro-3-(methoxymethyl)phenyl]propanoic acid is sourced from PubChem (CID 117364248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).