C8H10Cl2I2N2OPt — CID 10100974
3,5-dichloro-4-(1,2-diaminoethyl)phenol;platinum(2+);diiodide (PubChem CID 10100974) has the molecular formula C8H10Cl2I2N2OPt and a molecular weight of 669.97 g/mol. Its IUPAC name is 3,5-dichloro-4-(1,2-diaminoethyl)phenol;platinum(2+);diiodide.
| Compound Name | 3,5-dichloro-4-(1,2-diaminoethyl)phenol;platinum(2+);diiodide |
|---|---|
| PubChem CID | 10100974 |
| Molecular Formula | C8H10Cl2I2N2OPt |
| Molecular Weight | 669.97 g/mol |
| Exact Mass | 668.79 |
| IUPAC Name | 3,5-dichloro-4-(1,2-diaminoethyl)phenol;platinum(2+);diiodide |
| SMILES | NCC(N)c1c(Cl)cc(O)cc1Cl.[I-].[I-].[Pt+2] |
| InChI | InChI=1S/C8H10Cl2N2O.2HI.Pt/c9-5-1-4(13)2-6(10)8(5)7(12)3-11;;;/h1-2,7,13H,3,11-12H2;2*1H;/q;;;+2/p-2 |
| InChIKey | YGYQCBQMGZUWGM-UHFFFAOYSA-L |
| XLogP | -4.34 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.97 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|