C9H11Cl2FN2 — CID 131149390
(1R)-1-(3,6-dichloro-2-fluorophenyl)propane-1,3-diamine (PubChem CID 131149390) has the molecular formula C9H11Cl2FN2 and a molecular weight of 237.11 g/mol. Its IUPAC name is (1R)-1-(3,6-dichloro-2-fluorophenyl)propane-1,3-diamine.
| Compound Name | (1R)-1-(3,6-dichloro-2-fluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 131149390 |
| Molecular Formula | C9H11Cl2FN2 |
| Molecular Weight | 237.11 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (1R)-1-(3,6-dichloro-2-fluorophenyl)propane-1,3-diamine |
| SMILES | NCC[C@@H](N)c1c(Cl)ccc(Cl)c1F |
| InChI | InChI=1S/C9H11Cl2FN2/c10-5-1-2-6(11)9(12)8(5)7(14)3-4-13/h1-2,7H,3-4,13-14H2/t7-/m1/s1 |
| InChIKey | ZWYKWUDIKUEFDH-SSDOTTSWSA-N |
| XLogP | 2.48 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|