C10H15ClN2O — CID 77131244
4-(chloromethyl)-2-(1,2-diaminoethyl)-6-methylphenol (PubChem CID 77131244) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(1,2-diaminoethyl)-6-methylphenol.
| Compound Name | 4-(chloromethyl)-2-(1,2-diaminoethyl)-6-methylphenol |
|---|---|
| PubChem CID | 77131244 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-(chloromethyl)-2-(1,2-diaminoethyl)-6-methylphenol |
| SMILES | Cc1cc(CCl)cc(C(N)CN)c1O |
| InChI | InChI=1S/C10H15ClN2O/c1-6-2-7(4-11)3-8(10(6)14)9(13)5-12/h2-3,9,14H,4-5,12-13H2,1H3 |
| InChIKey | MYVISDOKUVOIPA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|