C9H15N3O — CID 66516744
2-amino-6-[(1R)-1,2-diaminoethyl]-4-methylphenol (PubChem CID 66516744) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-amino-6-[(1R)-1,2-diaminoethyl]-4-methylphenol.
| Compound Name | 2-amino-6-[(1R)-1,2-diaminoethyl]-4-methylphenol |
|---|---|
| PubChem CID | 66516744 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-amino-6-[(1R)-1,2-diaminoethyl]-4-methylphenol |
| SMILES | Cc1cc(N)c(O)c([C@@H](N)CN)c1 |
| InChI | InChI=1S/C9H15N3O/c1-5-2-6(8(12)4-10)9(13)7(11)3-5/h2-3,8,13H,4,10-12H2,1H3/t8-/m0/s1 |
| InChIKey | UFNLFKQSAMWNAE-QMMMGPOBSA-N |
| XLogP | 0.24 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|