C13H21Cl2NO — CID 171234640
2-[(1S)-1-amino-4-methylpentyl]-4-chloro-6-methylphenol;hydrochloride (PubChem CID 171234640) has the molecular formula C13H21Cl2NO and a molecular weight of 278.22 g/mol. Its IUPAC name is 2-[(1S)-1-amino-4-methylpentyl]-4-chloro-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-4-methylpentyl]-4-chloro-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171234640 |
| Molecular Formula | C13H21Cl2NO |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[(1S)-1-amino-4-methylpentyl]-4-chloro-6-methylphenol;hydrochloride |
| SMILES | Cc1cc(Cl)cc([C@@H](N)CCC(C)C)c1O.Cl |
| InChI | InChI=1S/C13H20ClNO.ClH/c1-8(2)4-5-12(15)11-7-10(14)6-9(3)13(11)16;/h6-8,12,16H,4-5,15H2,1-3H3;1H/t12-;/m0./s1 |
| InChIKey | YPEDEYXLPNHRRO-YDALLXLXSA-N |
| XLogP | 4.21 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|