C9H14N2O2 — CID 55264057
2-[(1S)-1,2-diaminoethyl]-4-(hydroxymethyl)phenol (PubChem CID 55264057) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-[(1S)-1,2-diaminoethyl]-4-(hydroxymethyl)phenol.
| Compound Name | 2-[(1S)-1,2-diaminoethyl]-4-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 55264057 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-[(1S)-1,2-diaminoethyl]-4-(hydroxymethyl)phenol |
| SMILES | NC[C@@H](N)c1cc(CO)ccc1O |
| InChI | InChI=1S/C9H14N2O2/c10-4-8(11)7-3-6(5-12)1-2-9(7)13/h1-3,8,12-13H,4-5,10-11H2/t8-/m1/s1 |
| InChIKey | WBIAZGIVJUJDTI-MRVPVSSYSA-N |
| XLogP | -0.16 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|