C6HBr3F4Mg — CID 175033297
magnesium;3-bromo-1,2,4,5-tetrafluorobenzene;dibromide (PubChem CID 175033297) has the molecular formula C6HBr3F4Mg and a molecular weight of 413.08 g/mol. Its IUPAC name is magnesium;3-bromo-1,2,4,5-tetrafluorobenzene;dibromide.
| Compound Name | magnesium;3-bromo-1,2,4,5-tetrafluorobenzene;dibromide |
|---|---|
| PubChem CID | 175033297 |
| Molecular Formula | C6HBr3F4Mg |
| Molecular Weight | 413.08 g/mol |
| Exact Mass | 409.74 |
| IUPAC Name | magnesium;3-bromo-1,2,4,5-tetrafluorobenzene;dibromide |
| SMILES | Fc1cc(F)c(F)c(Br)c1F.[Br-].[Br-].[Mg+2] |
| InChI | InChI=1S/C6HBrF4.2BrH.Mg/c7-4-5(10)2(8)1-3(9)6(4)11;;;/h1H;2*1H;/q;;;+2/p-2 |
| InChIKey | DWLJBPZTTRVYGJ-UHFFFAOYSA-L |
| XLogP | -3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.08 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|