C7H2BrF4N — CID 146309479
3-bromo-1,2,4,5-tetrafluorobenzene;formonitrile (PubChem CID 146309479) has the molecular formula C7H2BrF4N and a molecular weight of 256.00 g/mol. Its IUPAC name is 3-bromo-1,2,4,5-tetrafluorobenzene;formonitrile.
| Compound Name | 3-bromo-1,2,4,5-tetrafluorobenzene;formonitrile |
|---|---|
| PubChem CID | 146309479 |
| Molecular Formula | C7H2BrF4N |
| Molecular Weight | 256.00 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | 3-bromo-1,2,4,5-tetrafluorobenzene;formonitrile |
| SMILES | C#N.Fc1cc(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C6HBrF4.CHN/c7-4-5(10)2(8)1-3(9)6(4)11;1-2/h1H;1H |
| InChIKey | YQWVETDDAQNBPG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.00 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|