C10H8BrF2NO — CID 84810763
2-(3-bromo-4,5-difluoro-2-hydroxyphenyl)-2-methylpropanenitrile (PubChem CID 84810763) has the molecular formula C10H8BrF2NO and a molecular weight of 276.08 g/mol. Its IUPAC name is 2-(3-bromo-4,5-difluoro-2-hydroxyphenyl)-2-methylpropanenitrile.
| Compound Name | 2-(3-bromo-4,5-difluoro-2-hydroxyphenyl)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 84810763 |
| Molecular Formula | C10H8BrF2NO |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 2-(3-bromo-4,5-difluoro-2-hydroxyphenyl)-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1cc(F)c(F)c(Br)c1O |
| InChI | InChI=1S/C10H8BrF2NO/c1-10(2,4-14)5-3-6(12)8(13)7(11)9(5)15/h3,15H,1-2H3 |
| InChIKey | GWOSCGKLONWUHN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|