C10H12BrF2NO — CID 84811709
6-(2-amino-2-methylpropyl)-2-bromo-3,4-difluorophenol (PubChem CID 84811709) has the molecular formula C10H12BrF2NO and a molecular weight of 280.11 g/mol. Its IUPAC name is 6-(2-amino-2-methylpropyl)-2-bromo-3,4-difluorophenol.
| Compound Name | 6-(2-amino-2-methylpropyl)-2-bromo-3,4-difluorophenol |
|---|---|
| PubChem CID | 84811709 |
| Molecular Formula | C10H12BrF2NO |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 6-(2-amino-2-methylpropyl)-2-bromo-3,4-difluorophenol |
| SMILES | CC(C)(N)Cc1cc(F)c(F)c(Br)c1O |
| InChI | InChI=1S/C10H12BrF2NO/c1-10(2,14)4-5-3-6(12)8(13)7(11)9(5)15/h3,15H,4,14H2,1-2H3 |
| InChIKey | ILXNYBUQYGPWND-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|