C10H11BrF3N — CID 117452947
1-(3-bromo-2,4,6-trifluorophenyl)-2-methylpropan-2-amine (PubChem CID 117452947) has the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. Its IUPAC name is 1-(3-bromo-2,4,6-trifluorophenyl)-2-methylpropan-2-amine.
| Compound Name | 1-(3-bromo-2,4,6-trifluorophenyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 117452947 |
| Molecular Formula | C10H11BrF3N |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 1-(3-bromo-2,4,6-trifluorophenyl)-2-methylpropan-2-amine |
| SMILES | CC(C)(N)Cc1c(F)cc(F)c(Br)c1F |
| InChI | InChI=1S/C10H11BrF3N/c1-10(2,15)4-5-6(12)3-7(13)8(11)9(5)14/h3H,4,15H2,1-2H3 |
| InChIKey | HSFQHKKUBOWRCQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|