C10H12BrF2N — CID 84807348
1-(4-bromo-3,5-difluorophenyl)-2-methylpropan-2-amine (PubChem CID 84807348) has the molecular formula C10H12BrF2N and a molecular weight of 264.11 g/mol. Its IUPAC name is 1-(4-bromo-3,5-difluorophenyl)-2-methylpropan-2-amine.
| Compound Name | 1-(4-bromo-3,5-difluorophenyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 84807348 |
| Molecular Formula | C10H12BrF2N |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1-(4-bromo-3,5-difluorophenyl)-2-methylpropan-2-amine |
| SMILES | CC(C)(N)Cc1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C10H12BrF2N/c1-10(2,14)5-6-3-7(12)9(11)8(13)4-6/h3-4H,5,14H2,1-2H3 |
| InChIKey | UWKVZOJRYOSPTP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|