C12H18BrN — CID 84805283
1-(3-bromo-4,5-dimethylphenyl)-2-methylpropan-2-amine (PubChem CID 84805283) has the molecular formula C12H18BrN and a molecular weight of 256.19 g/mol. Its IUPAC name is 1-(3-bromo-4,5-dimethylphenyl)-2-methylpropan-2-amine.
| Compound Name | 1-(3-bromo-4,5-dimethylphenyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 84805283 |
| Molecular Formula | C12H18BrN |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 1-(3-bromo-4,5-dimethylphenyl)-2-methylpropan-2-amine |
| SMILES | Cc1cc(CC(C)(C)N)cc(Br)c1C |
| InChI | InChI=1S/C12H18BrN/c1-8-5-10(7-12(3,4)14)6-11(13)9(8)2/h5-6H,7,14H2,1-4H3 |
| InChIKey | ABXPFBGFWMDIDD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |