C10H10Br2F2 — CID 134387814
2,3-dibromo-1,5-difluoro-4-(2-methylpropyl)benzene (PubChem CID 134387814) has the molecular formula C10H10Br2F2 and a molecular weight of 327.99 g/mol. Its IUPAC name is 2,3-dibromo-1,5-difluoro-4-(2-methylpropyl)benzene.
| Compound Name | 2,3-dibromo-1,5-difluoro-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 134387814 |
| Molecular Formula | C10H10Br2F2 |
| Molecular Weight | 327.99 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | 2,3-dibromo-1,5-difluoro-4-(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1c(F)cc(F)c(Br)c1Br |
| InChI | InChI=1S/C10H10Br2F2/c1-5(2)3-6-7(13)4-8(14)10(12)9(6)11/h4-5H,3H2,1-2H3 |
| InChIKey | URDBMWXNYGEVEV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.99 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|