C15H17BrF2N2 — CID 102854999
5-bromo-N-ethyl-6,8-difluoro-2-(2-methylpropyl)quinolin-4-amine (PubChem CID 102854999) has the molecular formula C15H17BrF2N2 and a molecular weight of 343.22 g/mol. Its IUPAC name is 5-bromo-N-ethyl-6,8-difluoro-2-(2-methylpropyl)quinolin-4-amine.
| Compound Name | 5-bromo-N-ethyl-6,8-difluoro-2-(2-methylpropyl)quinolin-4-amine |
|---|---|
| PubChem CID | 102854999 |
| Molecular Formula | C15H17BrF2N2 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 5-bromo-N-ethyl-6,8-difluoro-2-(2-methylpropyl)quinolin-4-amine |
| SMILES | CCNc1cc(CC(C)C)nc2c(F)cc(F)c(Br)c12 |
| InChI | InChI=1S/C15H17BrF2N2/c1-4-19-12-6-9(5-8(2)3)20-15-11(18)7-10(17)14(16)13(12)15/h6-8H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | GSSNINPRRRBYBL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|