C15H17F3N2 — CID 63484388
2-tert-butyl-N-ethyl-5,6,8-trifluoroquinolin-4-amine (PubChem CID 63484388) has the molecular formula C15H17F3N2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-tert-butyl-N-ethyl-5,6,8-trifluoroquinolin-4-amine.
| Compound Name | 2-tert-butyl-N-ethyl-5,6,8-trifluoroquinolin-4-amine |
|---|---|
| PubChem CID | 63484388 |
| Molecular Formula | C15H17F3N2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-tert-butyl-N-ethyl-5,6,8-trifluoroquinolin-4-amine |
| SMILES | CCNc1cc(C(C)(C)C)nc2c(F)cc(F)c(F)c12 |
| InChI | InChI=1S/C15H17F3N2/c1-5-19-10-7-11(15(2,3)4)20-14-9(17)6-8(16)13(18)12(10)14/h6-7H,5H2,1-4H3,(H,19,20) |
| InChIKey | STJBLONFSZKBEC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|