C12H9F5N2 — CID 62893164
2-(difluoromethyl)-N-ethyl-5,6,8-trifluoroquinolin-4-amine (PubChem CID 62893164) has the molecular formula C12H9F5N2 and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-ethyl-5,6,8-trifluoroquinolin-4-amine.
| Compound Name | 2-(difluoromethyl)-N-ethyl-5,6,8-trifluoroquinolin-4-amine |
|---|---|
| PubChem CID | 62893164 |
| Molecular Formula | C12H9F5N2 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-(difluoromethyl)-N-ethyl-5,6,8-trifluoroquinolin-4-amine |
| SMILES | CCNc1cc(C(F)F)nc2c(F)cc(F)c(F)c12 |
| InChI | InChI=1S/C12H9F5N2/c1-2-18-7-4-8(12(16)17)19-11-6(14)3-5(13)10(15)9(7)11/h3-4,12H,2H2,1H3,(H,18,19) |
| InChIKey | MBLUQRYPVVMPOZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|