C13H11BrF4N2 — CID 102854988
5-bromo-2-(difluoromethyl)-6,8-difluoro-N-propylquinolin-4-amine (PubChem CID 102854988) has the molecular formula C13H11BrF4N2 and a molecular weight of 351.14 g/mol. Its IUPAC name is 5-bromo-2-(difluoromethyl)-6,8-difluoro-N-propylquinolin-4-amine.
| Compound Name | 5-bromo-2-(difluoromethyl)-6,8-difluoro-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 102854988 |
| Molecular Formula | C13H11BrF4N2 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 5-bromo-2-(difluoromethyl)-6,8-difluoro-N-propylquinolin-4-amine |
| SMILES | CCCNc1cc(C(F)F)nc2c(F)cc(F)c(Br)c12 |
| InChI | InChI=1S/C13H11BrF4N2/c1-2-3-19-8-5-9(13(17)18)20-12-7(16)4-6(15)11(14)10(8)12/h4-5,13H,2-3H2,1H3,(H,19,20) |
| InChIKey | NTSLDACDJBDHHF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|