C16H21BrN2 — CID 55194440
5-bromo-2-tert-butyl-N-ethyl-8-methylquinolin-4-amine (PubChem CID 55194440) has the molecular formula C16H21BrN2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 5-bromo-2-tert-butyl-N-ethyl-8-methylquinolin-4-amine.
| Compound Name | 5-bromo-2-tert-butyl-N-ethyl-8-methylquinolin-4-amine |
|---|---|
| PubChem CID | 55194440 |
| Molecular Formula | C16H21BrN2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-bromo-2-tert-butyl-N-ethyl-8-methylquinolin-4-amine |
| SMILES | CCNc1cc(C(C)(C)C)nc2c(C)ccc(Br)c12 |
| InChI | InChI=1S/C16H21BrN2/c1-6-18-12-9-13(16(3,4)5)19-15-10(2)7-8-11(17)14(12)15/h7-9H,6H2,1-5H3,(H,18,19) |
| InChIKey | DWIXVEJXXVBTAO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |