C12H15F3 — CID 139904745
1-ethyl-2,3,5-trifluoro-4-(2-methylpropyl)benzene (PubChem CID 139904745) has the molecular formula C12H15F3 and a molecular weight of 216.25 g/mol. Its IUPAC name is 1-ethyl-2,3,5-trifluoro-4-(2-methylpropyl)benzene.
| Compound Name | 1-ethyl-2,3,5-trifluoro-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 139904745 |
| Molecular Formula | C12H15F3 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1-ethyl-2,3,5-trifluoro-4-(2-methylpropyl)benzene |
| SMILES | CCc1cc(F)c(CC(C)C)c(F)c1F |
| InChI | InChI=1S/C12H15F3/c1-4-8-6-10(13)9(5-7(2)3)12(15)11(8)14/h6-7H,4-5H2,1-3H3 |
| InChIKey | ZFFJUJZCUJDYSB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|