C11H14F2 — CID 134572668
1,4-difluoro-2-methyl-5-(2-methylpropyl)benzene (PubChem CID 134572668) has the molecular formula C11H14F2 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1,4-difluoro-2-methyl-5-(2-methylpropyl)benzene.
| Compound Name | 1,4-difluoro-2-methyl-5-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 134572668 |
| Molecular Formula | C11H14F2 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1,4-difluoro-2-methyl-5-(2-methylpropyl)benzene |
| SMILES | Cc1cc(F)c(CC(C)C)cc1F |
| InChI | InChI=1S/C11H14F2/c1-7(2)4-9-6-10(12)8(3)5-11(9)13/h5-7H,4H2,1-3H3 |
| InChIKey | SSRQBBZIKZFQIP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |