C18H22F2O2 — CID 126545333
8-[1-(2,5-difluoro-4-methylphenyl)propan-2-yl]-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 126545333) has the molecular formula C18H22F2O2 and a molecular weight of 308.37 g/mol. Its IUPAC name is 8-[1-(2,5-difluoro-4-methylphenyl)propan-2-yl]-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 8-[1-(2,5-difluoro-4-methylphenyl)propan-2-yl]-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 126545333 |
| Molecular Formula | C18H22F2O2 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 8-[1-(2,5-difluoro-4-methylphenyl)propan-2-yl]-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | Cc1cc(F)c(CC(C)C2=CCC3(CC2)OCCO3)cc1F |
| InChI | InChI=1S/C18H22F2O2/c1-12(9-15-11-16(19)13(2)10-17(15)20)14-3-5-18(6-4-14)21-7-8-22-18/h3,10-12H,4-9H2,1-2H3 |
| InChIKey | NYLNADCLXAFIKX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|