C16H22O2 — CID 91004379
ethane;8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 91004379) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is ethane;8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | ethane;8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 91004379 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | ethane;8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | C1=C(c2ccccc2)CCC2(C1)OCCO2.CC |
| InChI | InChI=1S/C14H16O2.C2H6/c1-2-4-12(5-3-1)13-6-8-14(9-7-13)15-10-11-16-14;1-2/h1-6H,7-11H2;1-2H3 |
| InChIKey | ARBUEJNMHVUGJW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |