C8H12O2S — CID 141171889
1,4-dioxaspiro[4.5]dec-7-ene-8-thiol (PubChem CID 141171889) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]dec-7-ene-8-thiol.
| Compound Name | 1,4-dioxaspiro[4.5]dec-7-ene-8-thiol |
|---|---|
| PubChem CID | 141171889 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 1,4-dioxaspiro[4.5]dec-7-ene-8-thiol |
| SMILES | SC1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C8H12O2S/c11-7-1-3-8(4-2-7)9-5-6-10-8/h1,11H,2-6H2 |
| InChIKey | KTSIAXJLRGUMFT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|