About ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene
ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 144926160) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene.
Molecular Properties
| Compound Name | ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene |
| PubChem CID | 144926160 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | CC.CCC1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H16O2.C2H6/c1-2-9-3-5-10(6-4-9)11-7-8-12-10;1-2/h3H,2,4-8H2,1H3;1-2H3 |
| InChIKey | WEDMCOZCXRDZAR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene?
The IUPAC name of ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene (CID 144926160) is ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene.
What is the SMILES notation for ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene?
The canonical SMILES for ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene is CC.CCC1=CCC2(CC1)OCCO2.
What is the InChIKey of ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene?
The InChIKey is WEDMCOZCXRDZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2.C2H6/c1-2-9-3-5-10(6-4-9)11-7-8-12-10;1-2/h3H,2,4-8H2,1H3;1-2H3.
What are the key properties of ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene?
ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene has a molecular weight of 198.31 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene is sourced from PubChem (CID 144926160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).