C12H22O2 — CID 144926160
ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 144926160) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 144926160 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane;8-ethyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | CC.CCC1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H16O2.C2H6/c1-2-9-3-5-10(6-4-9)11-7-8-12-10;1-2/h3H,2,4-8H2,1H3;1-2H3 |
| InChIKey | WEDMCOZCXRDZAR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|