About 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene
8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 13213608) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene.
Molecular Properties
| Compound Name | 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene |
| PubChem CID | 13213608 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | C=CCC1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H16O2/c1-2-3-10-4-6-11(7-5-10)12-8-9-13-11/h2,4H,1,3,5-9H2 |
| InChIKey | OLMCIYCPPIZWPG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene?
The IUPAC name of 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene (CID 13213608) is 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene.
What is the SMILES notation for 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene?
The canonical SMILES for 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene is C=CCC1=CCC2(CC1)OCCO2.
What is the InChIKey of 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene?
The InChIKey is OLMCIYCPPIZWPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-10-4-6-11(7-5-10)12-8-9-13-11/h2,4H,1,3,5-9H2.
What are the key properties of 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene?
8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene has a molecular weight of 180.25 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene is sourced from PubChem (CID 13213608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).