C11H16O2 — CID 13213608
8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 13213608) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 13213608 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 8-prop-2-enyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | C=CCC1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H16O2/c1-2-3-10-4-6-11(7-5-10)12-8-9-13-11/h2,4H,1,3,5-9H2 |
| InChIKey | OLMCIYCPPIZWPG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|