C17H20F2O3 — CID 139776716
8-(2,3-difluoro-4-propoxyphenyl)-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 139776716) has the molecular formula C17H20F2O3 and a molecular weight of 310.34 g/mol. Its IUPAC name is 8-(2,3-difluoro-4-propoxyphenyl)-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 8-(2,3-difluoro-4-propoxyphenyl)-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 139776716 |
| Molecular Formula | C17H20F2O3 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 8-(2,3-difluoro-4-propoxyphenyl)-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | CCCOc1ccc(C2=CCC3(CC2)OCCO3)c(F)c1F |
| InChI | InChI=1S/C17H20F2O3/c1-2-9-20-14-4-3-13(15(18)16(14)19)12-5-7-17(8-6-12)21-10-11-22-17/h3-5H,2,6-11H2,1H3 |
| InChIKey | QDZFUWPLFJBJQJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |