C17H23F2O2 — CID 177267220
CID 177267220 (PubChem CID 177267220) has the molecular formula C17H23F2O2 and a molecular weight of 297.37 g/mol.
| Compound Name | CID 177267220 |
|---|---|
| PubChem CID | 177267220 |
| Molecular Formula | C17H23F2O2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | — |
| SMILES | CCCOc1ccc([C]2CCC(CCC)OC2)c(F)c1F |
| InChI | InChI=1S/C17H23F2O2/c1-3-5-13-7-6-12(11-21-13)14-8-9-15(20-10-4-2)17(19)16(14)18/h8-9,13H,3-7,10-11H2,1-2H3 |
| InChIKey | LLBVLRYOTAGWJZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |