C26H36F2O — CID 170655048
CID 170655048 (PubChem CID 170655048) has the molecular formula C26H36F2O and a molecular weight of 402.57 g/mol.
| Compound Name | CID 170655048 |
|---|---|
| PubChem CID | 170655048 |
| Molecular Formula | C26H36F2O |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | — |
| SMILES | CCOc1ccc([C]2CCC([C]3CCC(CCC4CCC4)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C26H36F2O/c1-2-29-24-17-16-23(25(27)26(24)28)22-14-12-21(13-15-22)20-10-8-19(9-11-20)7-6-18-4-3-5-18/h16-19,21H,2-15H2,1H3 |
| InChIKey | GUFOFSWYHACEQJ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |