C16H19F2O — CID 59875928
CID 59875928 (PubChem CID 59875928) has the molecular formula C16H19F2O and a molecular weight of 265.32 g/mol.
| Compound Name | CID 59875928 |
|---|---|
| PubChem CID | 59875928 |
| Molecular Formula | C16H19F2O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | — |
| SMILES | C=CCOc1ccc([C]2CCC(C)CC2)c(F)c1F |
| InChI | InChI=1S/C16H19F2O/c1-3-10-19-14-9-8-13(15(17)16(14)18)12-6-4-11(2)5-7-12/h3,8-9,11H,1,4-7,10H2,2H3 |
| InChIKey | XOMFBWAGBMXWOM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|