C16H12F4O2 — CID 118191628
1-(2,3-difluoro-4-methoxyphenyl)-2,3-difluoro-4-prop-2-enoxybenzene (PubChem CID 118191628) has the molecular formula C16H12F4O2 and a molecular weight of 312.26 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-methoxyphenyl)-2,3-difluoro-4-prop-2-enoxybenzene.
| Compound Name | 1-(2,3-difluoro-4-methoxyphenyl)-2,3-difluoro-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 118191628 |
| Molecular Formula | C16H12F4O2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(2,3-difluoro-4-methoxyphenyl)-2,3-difluoro-4-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(-c2ccc(OC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C16H12F4O2/c1-3-8-22-12-7-5-10(14(18)16(12)20)9-4-6-11(21-2)15(19)13(9)17/h3-7H,1,8H2,2H3 |
| InChIKey | BUKSFKIYOUWVLR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|