C19H19F3O2 — CID 118191516
1-butoxy-2,3-difluoro-4-(2-fluoro-4-prop-2-enoxyphenyl)benzene (PubChem CID 118191516) has the molecular formula C19H19F3O2 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-butoxy-2,3-difluoro-4-(2-fluoro-4-prop-2-enoxyphenyl)benzene.
| Compound Name | 1-butoxy-2,3-difluoro-4-(2-fluoro-4-prop-2-enoxyphenyl)benzene |
|---|---|
| PubChem CID | 118191516 |
| Molecular Formula | C19H19F3O2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-butoxy-2,3-difluoro-4-(2-fluoro-4-prop-2-enoxyphenyl)benzene |
| SMILES | C=CCOc1ccc(-c2ccc(OCCCC)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C19H19F3O2/c1-3-5-11-24-17-9-8-15(18(21)19(17)22)14-7-6-13(12-16(14)20)23-10-4-2/h4,6-9,12H,2-3,5,10-11H2,1H3 |
| InChIKey | OTFJUURCXBIMOP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|